CAS 65132-18-5 is the registry number for 1,5-Benzodiazepine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
1H-1,5-benzodiazepine;hydrochloride (CAS 65132-18-5) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: 1H-1,5-benzodiazepine;hydrochloride. InChIKey: VMLRGLWEZFXINP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 1H-1,5-benzodiazepine;hydrochloride |
| InChIKey | VMLRGLWEZFXINP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC=CC=N2.Cl |
Computed by PubChem (NCBI)