Products 65163-28-2

CAS 65163-28-2 is the registry number for dimethyl 2-(methyl-d3)malonate. Offered by: TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Dimethyl 2-(trideuteriomethyl)propanedioate (CAS 65163-28-2) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 149.16 g/mol. IUPAC name: dimethyl 2-(trideuteriomethyl)propanedioate. InChIKey: LRBPFPZTIZSOGG-FIBGUPNXSA-N.

Identity
Molecular formulaC6H10O4
Molecular weight149.16 g/mol
IUPAC namedimethyl 2-(trideuteriomethyl)propanedioate
InChIKeyLRBPFPZTIZSOGG-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)

Synonyms: orb2280957