CAS 65163-28-2 is the registry number for dimethyl 2-(methyl-d3)malonate. Offered by: TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
Dimethyl 2-(trideuteriomethyl)propanedioate (CAS 65163-28-2) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 149.16 g/mol. IUPAC name: dimethyl 2-(trideuteriomethyl)propanedioate. InChIKey: LRBPFPZTIZSOGG-FIBGUPNXSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 149.16 g/mol |
| IUPAC name | dimethyl 2-(trideuteriomethyl)propanedioate |
| InChIKey | LRBPFPZTIZSOGG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)