Products 65166-97-4
CAS 65166-97-4 appears in our catalog under these names: (-)-Esermethole, >95% (HPLC), Esermethole. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2,5mg, 5mg.
(3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (CAS 65166-97-4) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole. InChIKey: WKJDLYATGMSVOQ-KGLIPLIRSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| InChIKey | WKJDLYATGMSVOQ-KGLIPLIRSA-N |
| SMILES | C[C@@]12CCN([C@@H]1N(C3=C2C=C(C=C3)OC)C)C |
Computed by PubChem (NCBI)