CAS 65322-85-2 appears in our catalog under these names: Ibuprofen EP Impurity F, 3-(4-Isobutylphenyl)propanoic Acid, >95% (HPLC), Ibuprofen Impurity F, Ibuprofen Impurity F 97%, 3-(4-Isobutylphenyl)Propanoic Acid, 97%, 97%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 10g, 1g, 25mg, 100mg, 250mg, 5g, 25 mg.
3-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 65322-85-2) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 3-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: DYNVRFFVBZVRND-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 3-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | DYNVRFFVBZVRND-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)