CAS 6535-70-2 appears in our catalog under these names: 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid, 95%, 3-Aminonaphthalene-8-hydroxy-4,6-disulfonic acid, 3-Aminonaphthalene-8-hydroxy-4,6-disulfo, nic acid, 100 mg, 3-Aminonaphthalene-8-hydroxy-4,6-disulfo, nic acid, 250 mg, 3-Aminonaphthalene-8-hydroxy-4,6-disulfo, nic acid, 500 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 5g, 0,25g, 0,1g, 0,5g, 100mg, 250mg, 500mg.
2-amino-5-hydroxynaphthalene-1,7-disulfonic acid (CAS 6535-70-2) is a chemical compound with the molecular formula C10H9NO7S2 and a molecular weight of 319.3 g/mol. IUPAC name: 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid. InChIKey: HIVUAOXLSJITPA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO7S2 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid |
| InChIKey | HIVUAOXLSJITPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=CC(=C2)S(=O)(=O)O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)