CAS 82-47-3 is the registry number for 1-Amino-8-naphthol-2,4-disulfonic acid. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-hydroxynaphthalene-1,3-disulfonic acid (CAS 82-47-3) is a chemical compound with the molecular formula C10H9NO7S2 and a molecular weight of 319.3 g/mol. IUPAC name: 4-amino-5-hydroxynaphthalene-1,3-disulfonic acid. InChIKey: ZFRBZRZEKIOGQI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO7S2 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 4-amino-5-hydroxynaphthalene-1,3-disulfonic acid |
| InChIKey | ZFRBZRZEKIOGQI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=C(C=C2S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)