CAS 653584-65-7 appears in our catalog under these names: 2-Amino-pyridine-3-carbaldehyde oxime hydrochloride, 95%, 2-Aminonicotinaldehyde oxime hydrochloride, 98%, 98%, 2-Amino-pyridine-3-carbaldehyde oxime hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(NE)-N-[(2-amino-3-pyridinyl)methylidene]hydroxylamine;hydrochloride (CAS 653584-65-7) is a chemical compound with the molecular formula C6H8ClN3O and a molecular weight of 173.60 g/mol. IUPAC name: (NE)-N-[(2-amino-3-pyridinyl)methylidene]hydroxylamine;hydrochloride. InChIKey: DGNBEVBYMQDDDO-JOKMOOFLSA-N.
| Molecular formula | C6H8ClN3O |
|---|---|
| Molecular weight | 173.60 g/mol |
| IUPAC name | (NE)-N-[(2-amino-3-pyridinyl)methylidene]hydroxylamine;hydrochloride |
| InChIKey | DGNBEVBYMQDDDO-JOKMOOFLSA-N |
| SMILES | C1=CC(=C(N=C1)N)/C=N/O.Cl |
Computed by PubChem (NCBI)