Products 653589-16-3
CAS 653589-16-3 is the registry number for 1,2-Bis(1,1-dimethylethyl) (2S,4S)-4-hydroxy-6-oxo-1,2-piperidinedicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ditert-butyl (2S,4S)-4-hydroxy-6-oxopiperidine-1,2-dicarboxylate (CAS 653589-16-3) is a chemical compound with the molecular formula C15H25NO6 and a molecular weight of 315.36 g/mol. IUPAC name: ditert-butyl (2S,4S)-4-hydroxy-6-oxopiperidine-1,2-dicarboxylate. InChIKey: PKKJGCFMTULNMV-UWVGGRQHSA-N.
| Molecular formula | C15H25NO6 |
|---|---|
| Molecular weight | 315.36 g/mol |
| IUPAC name | ditert-butyl (2S,4S)-4-hydroxy-6-oxopiperidine-1,2-dicarboxylate |
| InChIKey | PKKJGCFMTULNMV-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](CC(=O)N1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)