CAS 654072-71-6 is the registry number for 2-Acetamidothiazole-4-sulfonyl Chloride. Offered by: TRC. Available pack sizes: 2,5g.
2-acetamido-1,3-thiazole-5-sulfonyl chloride (CAS 654072-71-6) is a chemical compound with the molecular formula C5H5ClN2O3S2 and a molecular weight of 240.7 g/mol. IUPAC name: 2-acetamido-1,3-thiazole-5-sulfonyl chloride. InChIKey: LYOHVKFYBJLEEP-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O3S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | 2-acetamido-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | LYOHVKFYBJLEEP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(S1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)