CAS 69812-30-2 appears in our catalog under these names: 2-Acetamidothiazole-5-sulfonyl chloride, 2-Acetylamino-thiazole-5-sulfonyl chloride, 95%, 2-Acetylamino-thiazole-5-sulfonyl chloride, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 500mg, 2.5g.
2-acetamido-1,3-thiazole-5-sulfonyl chloride (CAS 69812-30-2) is a chemical compound with the molecular formula C5H5ClN2O3S2 and a molecular weight of 240.7 g/mol. IUPAC name: 2-acetamido-1,3-thiazole-5-sulfonyl chloride. InChIKey: LYOHVKFYBJLEEP-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O3S2 |
|---|---|
| Molecular weight | 240.7 g/mol |
| IUPAC name | 2-acetamido-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | LYOHVKFYBJLEEP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(S1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)