Products 65515-26-6
CAS 65515-26-6 appears in our catalog under these names: Methyl 2,6–dimethoxynicotinate, Methyl 2,6-dimethoxynicotinate 97%, Methyl 2，6-dimethoxynicotinate, 97%, 97%, Methyl 2,6-dimethoxynicotinate, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
Methyl 2,6-dimethoxypyridine-3-carboxylate (CAS 65515-26-6) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: methyl 2,6-dimethoxypyridine-3-carboxylate. InChIKey: UFHAKDJNDMIPMV-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | methyl 2,6-dimethoxypyridine-3-carboxylate |
| InChIKey | UFHAKDJNDMIPMV-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)