Products 65515-33-5
CAS 65515-33-5 appears in our catalog under these names: 6-Chloro-2-methoxynicotinic acid, 6-Chloro-2-methoxynicotinic acid 98%, 6-Chloro-2-methoxynicotinic acid, 98%, 98%, 6-Chloro-2-methoxynicotinic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g.
6-chloro-2-methoxypyridine-3-carboxylic acid (CAS 65515-33-5) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 6-chloro-2-methoxypyridine-3-carboxylic acid. InChIKey: BWEDPOXJDWAJGX-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 6-chloro-2-methoxypyridine-3-carboxylic acid |
| InChIKey | BWEDPOXJDWAJGX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)