Products 65550-28-9

CAS 65550-28-9 is the registry number for Ethyl Nicotinate HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl pyridine-3-carboxylate;hydrochloride (CAS 65550-28-9) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: ethyl pyridine-3-carboxylate;hydrochloride. InChIKey: LYWSUZCAGACMEU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO2
Molecular weight187.62 g/mol
IUPAC nameethyl pyridine-3-carboxylate;hydrochloride
InChIKeyLYWSUZCAGACMEU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=CC=C1.Cl

Computed by PubChem (NCBI)