CAS 65566-62-3 appears in our catalog under these names: Antipyrine-d3, >95% (HPLC), Antipyrine-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Antipyrine-d3, 99.91%, D3-Antipyrine, D3-Antipyrine, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 10 mg, 5 mg, 1 mg, 1x10mg.
5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one (CAS 65566-62-3) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 191.24 g/mol. IUPAC name: 5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one. InChIKey: VEQOALNAAJBPNY-BMSJAHLVSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 191.24 g/mol |
| IUPAC name | 5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one |
| InChIKey | VEQOALNAAJBPNY-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=CC(=O)N1C2=CC=CC=C2)C |
Computed by PubChem (NCBI)