Products 65623-82-7
CAS 65623-82-7 appears in our catalog under these names: 4-(4-Acetyl-phenoxy)-butyric acid, 98%, 4–(4–Acetyl–phenoxy)–butyric acid, 4-(4-acetylphenoxy)butanoic acid, 4-(4-Acetylphenoxy)butanoic acid, 98%, 98%, AcBut, 98.07%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg, 25 mg, 100 mg.
4-(4-acetylphenoxy)butanoic acid (CAS 65623-82-7) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 4-(4-acetylphenoxy)butanoic acid. InChIKey: FNHIEZKOCYDCOH-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-(4-acetylphenoxy)butanoic acid |
| InChIKey | FNHIEZKOCYDCOH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OCCCC(=O)O |
Computed by PubChem (NCBI)