Products 65717-98-8
CAS 65717-98-8 is the registry number for 2,2'-((2-(Mesitylamino)-2-oxoethyl)azanediyl)diacetic Acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[carboxymethyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]acetic acid (CAS 65717-98-8) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[carboxymethyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]acetic acid. InChIKey: ZGXLCJXTSSBXPZ-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[carboxymethyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]acetic acid |
| InChIKey | ZGXLCJXTSSBXPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)CN(CC(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)