CAS 6578-07-0 appears in our catalog under these names: 5-Bromo-4-chloro-3-indolyl sulfate potassium salt, 95%, Potassium 5-bromo-4-chloro-1H-indol-3-yl sulfate, 95+%, 5-Bromo-4-chloro-3-indoxyl sulfate, potassium salt, 5-BROMO-4-CHLORO-3-INDOLYL SULFATE, Potassium 5-bromo-4-chloro-1H-indol-3-yl sulfate. Offered by: Combi-blocks, AmBeed, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 0,5g, 2,5g, Get quote.
Potassium (5-bromo-4-chloro-1H-indol-3-yl) sulfate (CAS 6578-07-0) is a chemical compound with the molecular formula C8H4BrClKNO4S and a molecular weight of 364.64 g/mol. IUPAC name: potassium (5-bromo-4-chloro-1H-indol-3-yl) sulfate. InChIKey: BONBCMDYPZGTEU-UHFFFAOYSA-M.
| Molecular formula | C8H4BrClKNO4S |
|---|---|
| Molecular weight | 364.64 g/mol |
| IUPAC name | potassium (5-bromo-4-chloro-1H-indol-3-yl) sulfate |
| InChIKey | BONBCMDYPZGTEU-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C2=C1NC=C2OS(=O)(=O)[O-])Cl)Br.[K+] |
Computed by PubChem (NCBI)