CAS 6581-24-4 appears in our catalog under these names: Potassium 5-bromo-6-chloro-1h-indol-3-yl sulfate, 95%, 5-Bromo-6-chloro-3-indolyl sulfate potassium salt. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
Potassium (5-bromo-6-chloro-1H-indol-3-yl) sulfate (CAS 6581-24-4) is a chemical compound with the molecular formula C8H4BrClKNO4S and a molecular weight of 364.64 g/mol. IUPAC name: potassium (5-bromo-6-chloro-1H-indol-3-yl) sulfate. InChIKey: UEICLAAARWXWFS-UHFFFAOYSA-M.
| Molecular formula | C8H4BrClKNO4S |
|---|---|
| Molecular weight | 364.64 g/mol |
| IUPAC name | potassium (5-bromo-6-chloro-1H-indol-3-yl) sulfate |
| InChIKey | UEICLAAARWXWFS-UHFFFAOYSA-M |
| SMILES | C1=C2C(=CC(=C1Br)Cl)NC=C2OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)