Products 65795-43-9
CAS 65795-43-9 is the registry number for 4-(1-Pyrrolidinylmethyl)aniline hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 5g.
7-[(4-chlorophenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine (CAS 65795-43-9) is a chemical compound with the molecular formula C17H14ClN5 and a molecular weight of 323.8 g/mol. IUPAC name: 7-[(4-chlorophenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine. InChIKey: IKTNEAXAJOAXRM-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN5 |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 7-[(4-chlorophenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine |
| InChIKey | IKTNEAXAJOAXRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N)Cl |
Computed by PubChem (NCBI)