CAS 71368-66-6 appears in our catalog under these names: 8-Aminoclonazolam, 7–Aminoclonazolam. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-amine (CAS 71368-66-6) is a chemical compound with the molecular formula C17H14ClN5 and a molecular weight of 323.8 g/mol. IUPAC name: 6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-amine. InChIKey: XGLOOOYZAISIOP-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN5 |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-amine |
| InChIKey | XGLOOOYZAISIOP-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)N)C(=NC2)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)