Products 65807-21-8
CAS 65807-21-8 appears in our catalog under these names: DL-Proline-d7 Hydrochloride, DL-Proline-d7, 98.0%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 250 mg, 100 mg.
1,2,3,3,4,4,5-heptadeuteriopyrrolidine-2-carboxylic acid;hydrochloride (CAS 65807-21-8) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 158.63 g/mol. IUPAC name: 1,2,3,3,4,4,5-heptadeuteriopyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UAGFTQCWTTYZKO-GOXZIFBESA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 158.63 g/mol |
| IUPAC name | 1,2,3,3,4,4,5-heptadeuteriopyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | UAGFTQCWTTYZKO-GOXZIFBESA-N |
| SMILES | [2H]C1C(C(C(N1[2H])([2H])C(=O)O)([2H])[2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)