Products 65807-22-9
CAS 65807-22-9 appears in our catalog under these names: L-Proline-2,5,5-d3, L-Proline-2,5,5-d3, 98 atom % D, min 98% Chemical Purity, L-Proline-2,5,5-d3, >95% (HPLC), L–Proline–d3, L-Proline-d3, 99.56%. Offered by: Chemat Brand, CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 0,25g, 0,1g, 1mg, 25mg, 10mg, 5mg, 50mg.
(2S)-2,5,5-trideuteriopyrrolidine-2-carboxylic acid (CAS 65807-22-9) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 118.15 g/mol. IUPAC name: (2S)-2,5,5-trideuteriopyrrolidine-2-carboxylic acid. InChIKey: ONIBWKKTOPOVIA-KIZNEYSQSA-N.
| Molecular formula | C5H9NO2 |
|---|---|
| Molecular weight | 118.15 g/mol |
| IUPAC name | (2S)-2,5,5-trideuteriopyrrolidine-2-carboxylic acid |
| InChIKey | ONIBWKKTOPOVIA-KIZNEYSQSA-N |
| SMILES | [2H][C@]1(CCC(N1)([2H])[2H])C(=O)O |
Computed by PubChem (NCBI)