Products 784086-28-8
CAS 784086-28-8 appears in our catalog under these names: DL-Proline-2,5,5-d3, DL-Proline-2,5,5-d3, 99 atom % D, min 98% Chemical Purity, H–DL–Pro–OH–d3, DL-Proline-d3, 99.67%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 10mg, 5 mg, 10 mg.
2,5,5-trideuteriopyrrolidine-2-carboxylic acid (CAS 784086-28-8) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 118.15 g/mol. IUPAC name: 2,5,5-trideuteriopyrrolidine-2-carboxylic acid. InChIKey: ONIBWKKTOPOVIA-FBYXXYQPSA-N.
| Molecular formula | C5H9NO2 |
|---|---|
| Molecular weight | 118.15 g/mol |
| IUPAC name | 2,5,5-trideuteriopyrrolidine-2-carboxylic acid |
| InChIKey | ONIBWKKTOPOVIA-FBYXXYQPSA-N |
| SMILES | [2H]C1(CCC(N1)([2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)