CAS 65872-43-7 is the registry number for 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid (CAS 65872-43-7) is a chemical compound with the molecular formula C7H7N3O4S and a molecular weight of 229.22 g/mol. IUPAC name: (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid. InChIKey: NRRJNSWNWIDHOX-YHYXMXQVSA-N.
| Molecular formula | C7H7N3O4S |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid |
| InChIKey | NRRJNSWNWIDHOX-YHYXMXQVSA-N |
| SMILES | CO/N=C(/C1=CSC(=N1)NC=O)\C(=O)O |
Computed by PubChem (NCBI)