Products 65872-43-7

CAS 65872-43-7 is the registry number for 2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid (CAS 65872-43-7) is a chemical compound with the molecular formula C7H7N3O4S and a molecular weight of 229.22 g/mol. IUPAC name: (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid. InChIKey: NRRJNSWNWIDHOX-YHYXMXQVSA-N.

Identity
Molecular formulaC7H7N3O4S
Molecular weight229.22 g/mol
IUPAC name(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid
InChIKeyNRRJNSWNWIDHOX-YHYXMXQVSA-N
SMILESCO/N=C(/C1=CSC(=N1)NC=O)\C(=O)O

Computed by PubChem (NCBI)