CAS 77357-00-7 is the registry number for NPys-Gly-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
2-[(3-nitro-2-pyridinyl)sulfanylamino]acetic acid (CAS 77357-00-7) is a chemical compound with the molecular formula C7H7N3O4S and a molecular weight of 229.22 g/mol. IUPAC name: 2-[(3-nitro-2-pyridinyl)sulfanylamino]acetic acid. InChIKey: GLAQXAHJBCWHSL-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4S |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | 2-[(3-nitro-2-pyridinyl)sulfanylamino]acetic acid |
| InChIKey | GLAQXAHJBCWHSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)SNCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)