Products 77357-00-7

CAS 77357-00-7 is the registry number for NPys-Gly-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(3-nitro-2-pyridinyl)sulfanylamino]acetic acid (CAS 77357-00-7) is a chemical compound with the molecular formula C7H7N3O4S and a molecular weight of 229.22 g/mol. IUPAC name: 2-[(3-nitro-2-pyridinyl)sulfanylamino]acetic acid. InChIKey: GLAQXAHJBCWHSL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7N3O4S
Molecular weight229.22 g/mol
IUPAC name2-[(3-nitro-2-pyridinyl)sulfanylamino]acetic acid
InChIKeyGLAQXAHJBCWHSL-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)SNCC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)