CAS 6597-51-9 is the registry number for 2-(2,4-Dimethylphenyl)acetohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dimethylphenyl)acetohydrazide (CAS 6597-51-9) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)acetohydrazide. InChIKey: ZCICNLIMIBXUOR-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)acetohydrazide |
| InChIKey | ZCICNLIMIBXUOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CC(=O)NN)C |
Computed by PubChem (NCBI)