CAS 661-97-2 is the registry number for 1,2-Dichlorohexafluoropropane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,2-dichloro-1,1,2,3,3,3-hexafluoropropane (CAS 661-97-2) is a chemical compound with the molecular formula C3Cl2F6 and a molecular weight of 220.93 g/mol. IUPAC name: 1,2-dichloro-1,1,2,3,3,3-hexafluoropropane. InChIKey: JSEUKVSKOHVLOV-UHFFFAOYSA-N.
| Molecular formula | C3Cl2F6 |
|---|---|
| Molecular weight | 220.93 g/mol |
| IUPAC name | 1,2-dichloro-1,1,2,3,3,3-hexafluoropropane |
| InChIKey | JSEUKVSKOHVLOV-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)Cl)(F)Cl |
Computed by PubChem (NCBI)