CAS 662-01-1 is the registry number for 1,3-dichloro-1,1,2,2,3,3-hexafluoropropane. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dichloro-1,1,2,2,3,3-hexafluoropropane (CAS 662-01-1) is a chemical compound with the molecular formula C3Cl2F6 and a molecular weight of 220.93 g/mol. IUPAC name: 1,3-dichloro-1,1,2,2,3,3-hexafluoropropane. InChIKey: JETINLPZEWINFD-UHFFFAOYSA-N.
| Molecular formula | C3Cl2F6 |
|---|---|
| Molecular weight | 220.93 g/mol |
| IUPAC name | 1,3-dichloro-1,1,2,2,3,3-hexafluoropropane |
| InChIKey | JETINLPZEWINFD-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)Cl)(C(F)(F)Cl)(F)F |
Computed by PubChem (NCBI)