CAS 66148-18-3 appears in our catalog under these names: DL-Nornicotine-D4, Nornicotine-d4, (R,S)-Nornicotine-d4, >95% (HPLC), (R,S)-Nornicotine-d4 (100 ug/mL in Methanol), (±)-Nornicotine-d4 (pyridine-d4), 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 5mg, 5x1ml, 0,25g, 0,1g, 1mg.
2,3,4,6-tetradeuterio-5-pyrrolidin-2-ylpyridine (CAS 66148-18-3) is a chemical compound with the molecular formula C9H12N2 and a molecular weight of 152.23 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-pyrrolidin-2-ylpyridine. InChIKey: MYKUKUCHPMASKF-DNZPNURCSA-N.
| Molecular formula | C9H12N2 |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-pyrrolidin-2-ylpyridine |
| InChIKey | MYKUKUCHPMASKF-DNZPNURCSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CCCN2)[2H] |
Computed by PubChem (NCBI)