CAS 66158-26-7 appears in our catalog under these names: 1-tert-Butyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%, 1-tert-Butyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 50mg, 0,5g.
1-tert-butyl-2-oxopyridine-3-carboxylic acid (CAS 66158-26-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-tert-butyl-2-oxopyridine-3-carboxylic acid. InChIKey: ODRSRNLRTYDDRX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 1-tert-butyl-2-oxopyridine-3-carboxylic acid |
| InChIKey | ODRSRNLRTYDDRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=CC=C(C1=O)C(=O)O |
Computed by PubChem (NCBI)