CAS 66171-75-3 is the registry number for (S)-Alaproclate. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, Get quote.
[1-(4-chlorophenyl)-2-methylpropan-2-yl] (2S)-2-aminopropanoate (CAS 66171-75-3) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: [1-(4-chlorophenyl)-2-methylpropan-2-yl] (2S)-2-aminopropanoate. InChIKey: FZSPJBYOKQPKCD-VIFPVBQESA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | [1-(4-chlorophenyl)-2-methylpropan-2-yl] (2S)-2-aminopropanoate |
| InChIKey | FZSPJBYOKQPKCD-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)OC(C)(C)CC1=CC=C(C=C1)Cl)N |
Computed by PubChem (NCBI)