Products 6619-97-2
CAS 6619-97-2 is the registry number for Xylopic acid. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.
(4S,10S,15R)-15-acetyloxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (CAS 6619-97-2) is a chemical compound with the molecular formula C22H32O4 and a molecular weight of 360.5 g/mol. IUPAC name: (4S,10S,15R)-15-acetyloxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid. InChIKey: AQBQBBLJTDSVLC-LLQRNYNASA-N.
| Molecular formula | C22H32O4 |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | (4S,10S,15R)-15-acetyloxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| InChIKey | AQBQBBLJTDSVLC-LLQRNYNASA-N |
| SMILES | CC(=O)O[C@@H]1C(=C)C2CC[C@@H]3C1(C2)CC[C@H]4C3(CCCC4(C)C(=O)O)C |
Computed by PubChem (NCBI)