CAS 66192-04-9 appears in our catalog under these names: 3-(2-Bromo-4-chlorophenyl)propanoic acid, 95%, 3-(2-Bromo-4-chlorophenyl)propanoic acid, 98%, 98%, 3-(2-BROMO-4-CHLORO-PHENYL)-PROPIONIC ACID, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-(2-bromo-4-chlorophenyl)propanoic acid (CAS 66192-04-9) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 3-(2-bromo-4-chlorophenyl)propanoic acid. InChIKey: XHXKZBOVNCLNHW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 3-(2-bromo-4-chlorophenyl)propanoic acid |
| InChIKey | XHXKZBOVNCLNHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)CCC(=O)O |
Computed by PubChem (NCBI)