Products 662138-96-7

CAS 662138-96-7 is the registry number for 2-Pyridineboronic acid N-phenyl-diethanolamine ester, 50-70%, see CofA for exact composition. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

6-phenyl-2-pyridin-2-yl-1,3,6,2-dioxazaborocane (CAS 662138-96-7) is a chemical compound with the molecular formula C15H17BN2O2 and a molecular weight of 268.12 g/mol. IUPAC name: 6-phenyl-2-pyridin-2-yl-1,3,6,2-dioxazaborocane. InChIKey: QDIQDVHNUYDVDD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17BN2O2
Molecular weight268.12 g/mol
IUPAC name6-phenyl-2-pyridin-2-yl-1,3,6,2-dioxazaborocane
InChIKeyQDIQDVHNUYDVDD-UHFFFAOYSA-N
SMILESB1(OCCN(CCO1)C2=CC=CC=C2)C3=CC=CC=N3

Computed by PubChem (NCBI)