CAS 662154-13-4 is the registry number for 1-(2-Bromophenyl)-2,5-dimethyl-1h-pyrrole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carbaldehyde (CAS 662154-13-4) is a chemical compound with the molecular formula C13H12BrNO and a molecular weight of 278.14 g/mol. IUPAC name: 1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carbaldehyde. InChIKey: PJLVJTIMOZSLLJ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| InChIKey | PJLVJTIMOZSLLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2Br)C)C=O |
Computed by PubChem (NCBI)