Products 66235-02-7
CAS 66235-02-7 is the registry number for 4-(2,3,5,6-Tetrahydroimidazo(2,1-b)thiazol-6-yl)benzenamine. Offered by: TRC. Available pack sizes: 25mg.
4-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)aniline (CAS 66235-02-7) is a chemical compound with the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. IUPAC name: 4-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)aniline. InChIKey: UTPPGYXTOFTCDF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3S |
|---|---|
| Molecular weight | 219.31 g/mol |
| IUPAC name | 4-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)aniline |
| InChIKey | UTPPGYXTOFTCDF-UHFFFAOYSA-N |
| SMILES | C1CSC2=NC(CN21)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)