CAS 76497-82-0 is the registry number for (S)-4-(2,3,5,6-Tetrahydroimidazo[2,1-b]thiazol-6-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]aniline (CAS 76497-82-0) is a chemical compound with the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. IUPAC name: 4-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]aniline. InChIKey: UTPPGYXTOFTCDF-SNVBAGLBSA-N.
| Molecular formula | C11H13N3S |
|---|---|
| Molecular weight | 219.31 g/mol |
| IUPAC name | 4-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]aniline |
| InChIKey | UTPPGYXTOFTCDF-SNVBAGLBSA-N |
| SMILES | C1CSC2=N[C@H](CN21)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)