CAS 66258-96-6 is the registry number for delta–Valerobetaine (hydrobromide). Offered by: GLPBio. Available pack sizes: 10mg.
5-(trimethylazaniumyl)pentanoate;hydrobromide (CAS 66258-96-6) is a chemical compound with the molecular formula C8H18BrNO2 and a molecular weight of 240.14 g/mol. IUPAC name: 5-(trimethylazaniumyl)pentanoate;hydrobromide. InChIKey: RPEYJGAXSPKPAL-UHFFFAOYSA-N.
| Molecular formula | C8H18BrNO2 |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 5-(trimethylazaniumyl)pentanoate;hydrobromide |
| InChIKey | RPEYJGAXSPKPAL-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCCCC(=O)[O-].Br |
Computed by PubChem (NCBI)