CAS 6626-66-0 is the registry number for 11H-Indeno[1,2-b]quinolin-11-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Indeno[1,2-b]quinolin-11-one (CAS 6626-66-0) is a chemical compound with the molecular formula C16H9NO and a molecular weight of 231.25 g/mol. IUPAC name: indeno[1,2-b]quinolin-11-one. InChIKey: XCNNXMKPXRCGJQ-UHFFFAOYSA-N.
| Molecular formula | C16H9NO |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | indeno[1,2-b]quinolin-11-one |
| InChIKey | XCNNXMKPXRCGJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C(=N2)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)