CAS 85985-43-9 appears in our catalog under these names: 1-Anthroylnitrile, 1–ANTHROYL CYANIDE, 1-Anthroylnitrile, 95%(HPLC), 95%(HPLC), Anthracene-1-carbonyl cyanide, 95%(HPLC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 50mg.
Anthracene-1-carbonyl cyanide (CAS 85985-43-9) is a chemical compound with the molecular formula C16H9NO and a molecular weight of 231.25 g/mol. IUPAC name: anthracene-1-carbonyl cyanide. InChIKey: UQJCYUIDHXVQDZ-UHFFFAOYSA-N.
| Molecular formula | C16H9NO |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | anthracene-1-carbonyl cyanide |
| InChIKey | UQJCYUIDHXVQDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3C(=O)C#N |
Computed by PubChem (NCBI)