Products 66311-22-6
CAS 66311-22-6 appears in our catalog under these names: Ethyl-d5-malonic Acid, 98 atom % D, min 98% Chemical Purity, Ethylmalonic acid–d5, Ethylmalonic acid-d5, 98.09%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5mg, 5 mg, 1 mg.
2-(1,1,2,2,2-pentadeuterioethyl)propanedioic acid (CAS 66311-22-6) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 137.15 g/mol. IUPAC name: 2-(1,1,2,2,2-pentadeuterioethyl)propanedioic acid. InChIKey: UKFXDFUAPNAMPJ-ZBJDZAJPSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 137.15 g/mol |
| IUPAC name | 2-(1,1,2,2,2-pentadeuterioethyl)propanedioic acid |
| InChIKey | UKFXDFUAPNAMPJ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)