CAS 70907-93-6 appears in our catalog under these names: Ethyl-2,2,2-d3-malonic Acid, 98 atom % D, min 98% Chemical Purity, Propanedioic acid,ethyl–2,2,2–d3– (9CI), Ethylmalonic acid–d3, Ethylmalonic acid-d3, 98.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 1mg, 5mg, 1 mg, 5 mg, 10 mg.
2-(2,2,2-trideuterioethyl)propanedioic acid (CAS 70907-93-6) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 135.13 g/mol. IUPAC name: 2-(2,2,2-trideuterioethyl)propanedioic acid. InChIKey: UKFXDFUAPNAMPJ-FIBGUPNXSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 135.13 g/mol |
| IUPAC name | 2-(2,2,2-trideuterioethyl)propanedioic acid |
| InChIKey | UKFXDFUAPNAMPJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)