Products 66537-40-4
CAS 66537-40-4 appears in our catalog under these names: Theaspirane B, (+)-Theaspirane B. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
(2R,5S)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene (CAS 66537-40-4) is a chemical compound with the molecular formula C13H22O and a molecular weight of 194.31 g/mol. IUPAC name: (2R,5S)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene. InChIKey: GYUZHTWCNKINPY-DGCLKSJQSA-N.
| Molecular formula | C13H22O |
|---|---|
| Molecular weight | 194.31 g/mol |
| IUPAC name | (2R,5S)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene |
| InChIKey | GYUZHTWCNKINPY-DGCLKSJQSA-N |
| SMILES | C[C@@H]1CC[C@@]2(O1)C(=CCCC2(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
(+)-theaspirane b, 1-Oxaspiro(4.5)dec-6-ene, 2,6,10,10-tetramethyl-, (2R,5S)-, 1-Oxaspiro(4.5)dec-6-ene, 2,6,10,10-tetramethyl-, (2R-cis)-, (2R,5S)-2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene, (+-)-Theaspirane b, Theaspirane B, (+-)-, (+/-)-THEASPIRANE B, THEASPIRANE B, (+)-, GYUZHTWCNKINPY-DGCLKSJQSA-N, (2R,5S)-2,6,10,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene