CAS 6655-80-7 appears in our catalog under these names: 4-Chloro-3-nitrobenzenesulfonohydrazide, 95%, 4-Chloro-3-nitrobenzene-1-sulfonohydrazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
4-chloro-3-nitrobenzenesulfonohydrazide (CAS 6655-80-7) is a chemical compound with the molecular formula C6H6ClN3O4S and a molecular weight of 251.65 g/mol. IUPAC name: 4-chloro-3-nitrobenzenesulfonohydrazide. InChIKey: JCIYPXNOFMKDLV-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O4S |
|---|---|
| Molecular weight | 251.65 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzenesulfonohydrazide |
| InChIKey | JCIYPXNOFMKDLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)NN)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)