CAS 81377-14-2 appears in our catalog under these names: 4-Chloro-7-sulfobenzofurazan ammonium salt, 95%, 4–Chloro–7–sulfobenzofurazan ammonium salt, 4-Chloro-7-sulfobenzofurazan ammonium salt, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
Azane;4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid (CAS 81377-14-2) is a chemical compound with the molecular formula C6H6ClN3O4S and a molecular weight of 251.65 g/mol. IUPAC name: azane;4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid. InChIKey: QFHXPBLOMHGYOC-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O4S |
|---|---|
| Molecular weight | 251.65 g/mol |
| IUPAC name | azane;4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid |
| InChIKey | QFHXPBLOMHGYOC-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)Cl)S(=O)(=O)O.N |
Computed by PubChem (NCBI)