Products 66556-91-0
CAS 66556-91-0 appears in our catalog under these names: Ent-3β-hydroxykaur-16-en-19-oic acid, ent-3β-Hydroxykaur-16-en-19-oic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
6-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (CAS 66556-91-0) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: 6-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid. InChIKey: KCJVDDSMQGJVAF-UHFFFAOYSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 6-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| InChIKey | KCJVDDSMQGJVAF-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(C1CCC34C2CCC(C3)C(=C)C4)(C)C(=O)O)O |
Computed by PubChem (NCBI)