CAS 666211-30-9 appears in our catalog under these names: Tenovin-2, 95%, Tenovin-2, Tenovin-2, 97%, 97%. Offered by: Combi-blocks, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
4-tert-butyl-N-[[4-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide (CAS 666211-30-9) is a chemical compound with the molecular formula C22H27N3O2S and a molecular weight of 397.5 g/mol. IUPAC name: 4-tert-butyl-N-[[4-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide. InChIKey: BRWAJDBGZFTAQH-UHFFFAOYSA-N.
| Molecular formula | C22H27N3O2S |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 4-tert-butyl-N-[[4-(2-methylpropanoylamino)phenyl]carbamothioyl]benzamide |
| InChIKey | BRWAJDBGZFTAQH-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC=C(C=C1)NC(=S)NC(=O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)