CAS 959395-84-7 is the registry number for SUVN-507. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-methylpiperazin-1-yl)-1-(4-propan-2-ylphenyl)sulfonylindole (CAS 959395-84-7) is a chemical compound with the molecular formula C22H27N3O2S and a molecular weight of 397.5 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)-1-(4-propan-2-ylphenyl)sulfonylindole. InChIKey: DOUUUDLTKJRZKD-UHFFFAOYSA-N.
| Molecular formula | C22H27N3O2S |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)-1-(4-propan-2-ylphenyl)sulfonylindole |
| InChIKey | DOUUUDLTKJRZKD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)N4CCN(CC4)C |
Computed by PubChem (NCBI)