CAS 66737-88-0 appears in our catalog under these names: 3-tert-Butyl-4-hydroxybenzoic acid, 97%, 3–TERT–BUTYL–4–HYDROXYBENZOIC ACID, 3-tert-Butyl-4-hydroxybenzoic acid, 3-(tert-Butyl)-4-hydroxybenzoic acid 98%, 3-(Tert-butyl)-4-hydroxybenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 1000mg, 500mg, 2000mg, 5000mg.
3-tert-butyl-4-hydroxybenzoic acid (CAS 66737-88-0) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-tert-butyl-4-hydroxybenzoic acid. InChIKey: PVFDJRIEGYDIEK-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-tert-butyl-4-hydroxybenzoic acid |
| InChIKey | PVFDJRIEGYDIEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C(=O)O)O |
Computed by PubChem (NCBI)