CAS 667864-91-7 appears in our catalog under these names: 3-(4-Chlorophenyl)pentan-3-amine hydrochloride, 95%, 3-(4-Chlorophenyl)pentan-3-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(4-chlorophenyl)pentan-3-amine;hydrochloride (CAS 667864-91-7) is a chemical compound with the molecular formula C11H17Cl2N and a molecular weight of 234.16 g/mol. IUPAC name: 3-(4-chlorophenyl)pentan-3-amine;hydrochloride. InChIKey: GTIFSFQABYBMIZ-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N |
|---|---|
| Molecular weight | 234.16 g/mol |
| IUPAC name | 3-(4-chlorophenyl)pentan-3-amine;hydrochloride |
| InChIKey | GTIFSFQABYBMIZ-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)